Mephedrone
| Mephedrone | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C11H15NO |
| Molecular mass | 177.24 g/mol |
| Appearance | Fine-white to off-white or slightly colored powder ... also found in tablet or capsule form |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-(methylamino)-1-(4-methylphenyl)propan-1-one |
| Cannonical SMILES | CC1=CC=C(C=C1)C(=O)C(C)NC |
| InChI | InChI=1S/C11H15NO/c1-8-4-6-10(7-5-8)11(13)9(2)12-3/h4-7,9,12H,1-3H3 |
| InChIKey | YELGFTGWJGBAQU-UHFFFAOYSA-N |
Mephedrone (also known as 4-methylmethcathinone, Meow meow, 4-MMC, M-CAT, Bounce, Bubbles, Mad cow, 4-methylephedrone, bk-4-methylmethamphetamine or beta-keto-4-methylmethamphetamine) is a stimulant substance of the methcathinone class.
Chemistry
Mephedrone is typically prepared in the form of its amine salts hydrochloride.
Mephedrone is a racemic mixture of two optical stereoisomers.