Cathinone
| Cathinone | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C9H11NO |
| Molecular mass | 149.19 g/mol |
| Appearance | Pale yellow leaf from petroleum ether |
| Melting point | 46.5 °C |
| Boiling point | 93 °C |
| Decomposition | Hazardous decomposition products formed under fire conditions. - Carbon oxides, nitrogen oxides (NOx), Hydrogen chloride gas. /S(-)-Cathinone hydrochloride/ |
| Solubility | Very soluble in ether, ethanol |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-amino-1-phenylpropan-1-one |
| Cannonical SMILES | CC(C(=O)C1=CC=CC=C1)N |
| InChI | InChI=1S/C9H11NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7H,10H2,1H3 |
| InChIKey | PUAQLLVFLMYYJJ-UHFFFAOYSA-N |
Cathinone (also known as 2-Aminopropiophenone, 2-Amino-1-phenyl-1-propanone, (+/-)-Cathinone, 1-Propanone, 2-amino-1-phenyl-, alpha-Aminopropiophenone, Cathinine, 2-Amino-2-methylacetophenone, CHEBI:59332, (-)-alpha-Amino-propiophenone or Abyssiniantea) is a stimulant substance of the cathinone class.
Chemistry
Cathinone is a racemic mixture of two optical stereoisomers.