Dextroamphetamine
| Dextroamphetamine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C9H13N |
| Molecular mass | 135.21 g/mol |
| Density | 0.949 g/cm3 |
| Appearance | Colorless liquid |
| Melting point | 27.5 °C |
| Boiling point | 203.5 °C |
| Decomposition | When heated to decomposition it emits toxic nitroxides. |
| Solubility | Moderately Soluble |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (2S)-1-phenylpropan-2-amine |
| Cannonical SMILES | CC(CC1=CC=CC=C1)N |
| InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m0/s1 |
| InChIKey | KWTSXDURSIMDCE-QMMMGPOBSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 5 mg |
| Light | 5 - 15 mg |
| Common | 15 - 30 mg |
| Strong | 30 mg |
| Heavy | 30 - 45 mg |
| Statistically derived dosages by Sernyl |
Dextroamphetamine (also known as D-Amphetamine, (S)-Amphetamine, (+)-Amphetamine, XELSTRYM, Dexamphetamine, Dexamfetamine, (+)-(S)-Amphetamine, Dexadrine, Dexidrine or (S)-(+)-Amphetamine) is a stimulant substance of the amphetamine class.
Chemistry
Dextroamphetamine is typically prepared in the form of its amine salts phosphate, saccharate, adipate, sulfate and hydrochloride.
Dextroamphetamine is a absolute mixture