Bupropion
| Bupropion | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C13H18ClNO |
| Molecular mass | 239.74 g/mol |
| Appearance | Pale yellow oil |
| Melting point | 233-234 °C |
| Boiling point | 52 °C |
| Solubility | Very hygroscopic and susceptible to decomposition |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-one |
| Cannonical SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)NC(C)(C)C |
| InChI | InChI=1S/C13H18ClNO/c1-9(15-13(2,3)4)12(16)10-6-5-7-11(14)8-10/h5-9,15H,1-4H3 |
| InChIKey | SNPPWIUOZRMYNY-UHFFFAOYSA-N |
| Dosing |
|---|
| Insufflated [] | |
|---|---|
| Threshold | 1 - 26.250000000000007 mg |
| Light | 26.250000000000007 - 75 mg |
| Common | 75 - 150 mg |
| Strong | 150 mg |
| Heavy | 150 - 222.49999999999997 mg |
| Oral [] | |
|---|---|
| Threshold | 1 - 82.50000000000001 tablet |
| Light | 82.50000000000001 - 150 tablet |
| Common | 150 - 300 tablet |
| Strong | 300 - 450 tablet |
| Heavy | 450 - 600 tablet |
| Statistically derived dosages by Sernyl |
Bupropion (also known as Amfebutamone, Amfebutamon, Wellbutrin, 34841-39-9, amfebutamonum, Amfebutamona, Elontril, (+-)-Bupropion, Wellbatrin or Amfebutamonum [INN-Latin]) is a depressant substance of the methcathinone class.
Chemistry
Bupropion is typically prepared in the form of its amine salts hydrobromide, hydrochloride and maleate.
Bupropion is a racemic mixture of two optical stereoisomers.