Pseudoephedrine
| Pseudoephedrine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C10H15NO |
| Molecular mass | 165.23 g/mol |
| Appearance | Crystals from ether |
| Melting point | 118-118.7 °C |
| Solubility | Sparingly sol in water; freely sol in alc or ether |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (1S,2S)-2-(methylamino)-1-phenylpropan-1-ol |
| Cannonical SMILES | CC(C(C1=CC=CC=C1)O)NC |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1 |
| InChIKey | KWGRBVOPPLSCSI-WCBMZHEXSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 2 - 60 mg |
| Light | 60 - 120 mg |
| Common | 120 mg |
| Strong | 120 mg |
| Heavy | 120 - 180 mg |
| Statistically derived dosages by Sernyl |
Pseudoephedrine (also known as (+)-Pseudoephedrine, d-Pseudoephedrine, Isoephedrine, trans-Ephedrine, d-Isoephedrine, Psi-ephedrin, Psi-ephedrine, (+)-threo-Ephedrine, d-psi-Ephedrine or Sudafed) is a substance of the methamphetamine class.
Chemistry
Pseudoephedrine is typically prepared in the form of its amine salts hydrochloride, sulfate, hydrobromide and tannate.
Pseudoephedrine is a absolute mixture