Bluedark| Testosterone | |
|---|---|
 |
| Esters [] | |
|---|---|
| Testosterone acetate | |
| |
| Testosterone benzoate | |
| |
| Testosterone valerate | |
| |
| Testosterone cypionate | |
| |
| Testosterone enantate | |
| |
| Testosterone undecylate | |
| |
| Testosterone propionate | |
| |
| Testosterone dipropionate | |
| |
| Testosterone stearate | |
| |
| Testosterone palmitate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C19H28O2 |
|---|---|
| Molecular mass | 288.4 g/mol |
| Appearance | White needles from dilute acetone |
| Odor | Odorless |
| Predicted LogP | 3.3 |
| Melting point | 151.0 °C |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. |
| Solubility | In water, 23.4 mg/L at 25 °C |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@]34C |
| InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | MUMGGOZAMZWBJJ-DYKIIFRCSA-N |
Testosterone
Testosterone (also known as Testosteron, Androderm, Testim, Homosterone, Virosterone, Testiculosterone, Androlin, Mertestate, Sustanon or Testoderm) is a hormone substance of the steroid class.
Chemistry
Testosterone is typically found in the form of its acetate, benzoate, valerate, cypionate, enantate, undecylate, propionate, dipropionate, stearate and palmitate esters.