Temazepam | |
---|---|
Molecular structure via molpic | |
| |
Molecular formula | C16H13ClN2O2 |
Molecular mass | 300.74 g/mol |
Predicted LogP | 2.2 |
Melting point | 119-121 °C |
Solubility | 5.34e-02 g/L |
Identifiers [] | |
---|---|
IUPAC name | 7-chloro-3-hydroxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
SMILES | CN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)O)C3=CC=CC=C3 |
InChI | InChI=1S/C16H13ClN2O2/c1-19-13-8-7-11(17)9-12(13)14(18-15(20)16(19)21)10-5-3-2-4-6-10/h2-9,15,20H,1H3 |
InChIKey | SEQDDYPDSLOBDC-UHFFFAOYSA-N |
Dosing |
---|
Oral [] | |
---|---|
Threshold | 1 - 2.8000000000000003 mg |
Light | 2.8000000000000003 - 20 mg |
Common | 20 - 30 mg |
Strong | 30 - 60 mg |
Heavy | 60 mg |
Statistically derived dosages by Sernyl |
Temazepam
Temazepam (also known as Restoril, Hydroxydiazepam, Methyloxazepam, Oxydiazepam, Crisonar, Levanxene, Levanxol, N-Methyloxazepam, Euhypnos or Mabertin) is a substance of the benzodiazepine class.