Salbutamol
| Salbutamol | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C13H21NO3 |
| Molecular mass | 239.31 g/mol |
| Appearance | White to off-white crystalline solid |
| Melting point | 147-149 |
| Solubility | Soluble in ethanol, sparingly soluble in water, and very soluble in chlorform. |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| Cannonical SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3 |
| InChIKey | NDAUXUAQIAJITI-UHFFFAOYSA-N |
Salbutamol (also known as albuterol, Proventil, Ventoline, Broncovaleas, dl-Albuterol, Salbutamolum, Asthalin, Cobutolin, Salbulin or Salbuvent) is a substance of the phenethylamine class.
Chemistry
Salbutamol is typically prepared in the form of its amine salts albuterol adipate diethanolate, albuterol sulfate, albuterol hydrochloride and albuterol hemisuccinate.
Salbutamol is a racemic mixture of two optical stereoisomers.