Pregabalin
| Pregabalin | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C8H17NO2 |
| Molecular mass | 159.23 g/mol |
| Appearance | White to off-white crystalline solid |
| Melting point | 186-188 °C |
| Solubility | Freely soluble |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (3S)-3-(aminomethyl)-5-methylhexanoic acid |
| Cannonical SMILES | CC(C)CC(CC(=O)O)CN |
| InChI | InChI=1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | AYXYPKUFHZROOJ-ZETCQYMHSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 75 mg |
| Light | 75 - 150 mg |
| Common | 150 - 300 mg |
| Strong | 300 - 600 mg |
| Heavy | 600 - 800 mg |
| Statistically derived dosages by Sernyl |
Pregabalin (also known as Lyrica, (S)-3-(Aminomethyl)-5-methylhexanoic acid, 3-isobutyl GABA, (S)-Pregabalin, CI-1008, Pregabalina, Pregabaline, Vronogabic, Pregabalin mylan or Pregabalin sandoz) is a [calcium channel blocker](/class/calcium channel blocker) substance of the gabapentinoid class.
Chemistry
Pregabalin is typically prepared in the form of its amine salts hydrochloride and sodium.
Pregabalin is a absolute mixture
See also
- [Calcium Channel Blocker](/class/calcium channel blocker)
- Depressant
- Substituted gabapentinoids