Bluedark| Piracetam | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C6H10N2O2 |
| Molecular mass | 142.16 g/mol |
| Appearance | Crystals from isopropanol |
| Predicted LogP | -1.3 |
| Melting point | 151.5 - 152.5 °C |
| Boiling point | Decomposes |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-(2-oxopyrrolidin-1-yl)acetamide |
| Cannonical SMILES | C1CC(=O)N(C1)CC(=O)N |
| InChI | InChI=1S/C6H10N2O2/c7-5(9)4-8-3-1-2-6(8)10/h1-4H2,(H2,7,9) |
| InChIKey | GMZVRMREEHBGGF-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 0.5 - 1.0500000000000007 g |
| Light | 1.0500000000000007 - 2.1 g |
| Common | 2.1 - 5.7 g |
| Strong | 5.7 - 800 g |
| Heavy | 800 - 1600 g |
| Statistically derived dosages by Sernyl |
Piracetam
Piracetam (also known as Nootropil, 2-Oxo-1-pyrrolidineacetamide, 1-Pyrrolidineacetamide, 2-oxo-, Nootropyl, Pyracetam, Normabrain, Gabacet, Pyramem, Ciclofalina or Euvifor) is a stimulant substance of the racetam class.