PPA | |
---|---|
Salts [] | |
---|---|
Phenylpropanolamine hydrochloride | |
Molecular structure via molpic | |
| |
Molecular formula | C9H13NO |
---|---|
Molecular mass | 151.21 g/mol |
Appearance | White, crystalline powder |
Odor | Slight aromatic odor |
Predicted LogP | 0.8 |
Melting point | 190-194 °C |
Decomposition | When heated to decomposition it emits very toxic fumes of nitroxides. |
Solubility | Freely soluble |
Chirality | absolute |
Identifiers [] | |
---|---|
IUPAC name | (1S,2R)-2-amino-1-phenylpropan-1-ol |
SMILES | C[C@H]([C@H](C1=CC=CC=C1)O)N |
InChI | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9-/m1/s1 |
InChIKey | DLNKOYKMWOXYQA-VXNVDRBHSA-N |
Phenylpropanolamine
Phenylpropanolamine (also known as Norephedrine, (+)-Norephedrine, dl-Norephedrine, d-Norephedrine, Propadrine, 1r,2s-phenylpropylamine, (+)-phenylpropanolamine, 37577-28-9, (1s,2r)-norephedrine or d-Phenylpropanolamine) is a depressant substance of the amphetamine class.
Chemistry
Phenylpropanolamine is typically found in the form of its hydrochloride salt.
Stereochemistry
Phenylpropanolamine is a absolute mixtureSee also
External links
- Phenylpropanolamine (Wikipedia)
- Phenylpropanolamine (Wikidata)
- Phenylpropanolamine (DrugBank)
- Phenylpropanolamine (PubChem)
- Phenylpropanolamine (ChemSpider)
- Phenylpropanolamine (ChEMBL)
- Phenylpropanolamine (ChEBI)
- Phenylpropanolamine (Common Chemistry)
- Phenylpropanolamine (HMDB)
- Phenylpropanolamine (KEGG)
- Phenylpropanolamine (UNII)
- Phenylpropanolamine (EPA DSSTox)