Bluedark| Phenibut | |
|---|---|
 | |
| Molecular structure via molpic | |
|
| |
| Molecular formula | C10H13NO2 |
| Molecular mass | 179.22 g/mol |
| Predicted LogP | -1.6 |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-amino-3-phenylbutanoic acid |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)CN |
| InChI | InChI=1S/C10H13NO2/c11-7-9(6-10(12)13)8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13) |
| InChIKey | DAFOCGYVTAOKAJ-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 0.5 - 1 g |
| Light | 1 g |
| Common | 1 - 2 g |
| Strong | 2 - 3 g |
| Heavy | 3 - 4 g |
| Statistically derived dosages by Sernyl |
Phenibut
Phenibut (also known as 4-Amino-3-phenylbutanoic acid, Fenibut, 4-Amino-3-phenylbutyric acid, PhGaba, Phenylgamma, phenigamma, Fenigam, Fenigama, Phenigam or Phenylgam) is a substance of the gabapentinoid class.