Bluedark| Phendimetrazine | |
|---|---|
 |
| Salts [] | |
|---|---|
| Phendimetrazine fumarate | |
| |
| Phendimetrazine hydrochloride | |
| |
| Phendimetrazine tartrate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C12H17NO |
|---|---|
| Molecular mass | 191.27 g/mol |
| Appearance | White powder |
| Odor | Odorless |
| Taste | Bitter |
| Predicted LogP | 1.9 |
| Melting point | 208 °C |
| Boiling point | 122-124 °C at 8 mm Hg; 134-135 °C at 12 mm Hg |
| Decomposition | When heated to decomp it emits very toxic fumes of /nitrogen oxides and hydrogen chloride/. /Phendimetrazine hydrochloride/ |
| Solubility | Free sol in water; very slightly sol in alcohol; practically insol in chloroform and ether. |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (2S,3S)-3,4-dimethyl-2-phenylmorpholine |
| SMILES | C[C@H]1[C@@H](OCCN1C)C2=CC=CC=C2 |
| InChI | InChI=1S/C12H17NO/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | MFOCDFTXLCYLKU-CMPLNLGQSA-N |
Phendimetrazine
Phendimetrazine (also known as Mephenmetrazine, Fendimetrazina, Phendimetrazinum, Antapentan, Sedafamen, (2S,3S)-3,4-Dimethyl-2-phenylmorpholine, (2R-trans)-3,4-Dimethyl-2-phenylmorpholine, 3,4-Dimethyl-2-phenyltetrahydro-1,4-oxazine, AB2794W8KV or Morpholine, 3,4-dimethyl-2-phenyl-, (2S-trans)-) is a depressant substance of the phenylmorpholine class.
Chemistry
Phendimetrazine is typically found in the form of its fumarate, hydrochloride, succinate and tartrate salts.