Phencyclidine
| Phencyclidine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C17H25N |
| Molecular mass | 243.4 g/mol |
| Appearance | White, crystalline powder |
| Odor | Oily, slightly ammoniac |
| Melting point | 46.5 °C |
| Boiling point | 136 °C |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. |
| Solubility | Soluble in ethanol |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 1-(1-phenylcyclohexyl)piperidine |
| Cannonical SMILES | C1CCC(CC1)(C2=CC=CC=C2)N3CCCCC3 |
| InChI | InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2 |
| InChIKey | JTJMJGYZQZDUJJ-UHFFFAOYSA-N |
Phencyclidine (also known as 1-(1-Phenylcyclohexyl)piperidine, Angel dust, Fenciclidina, Dust, Killer weed, Phencyclidinum, Piperidine, 1-(1-phenylcyclohexyl)-, Supergrass, Cadillac or Crystal) is a anaesthetic substance of the amine class.
Chemistry
Phencyclidine is typically prepared in the form of its amine salts hydrochloride.
Phencyclidine is a achiral mixture