Bluedark| Pemoline | |
|---|---|
 | |
| Molecular structure via molpic | |
|
| |
| Molecular formula | C9H8N2O2 |
| Molecular mass | 176.17 g/mol |
| Appearance | Crystals |
| Taste | Tasteless |
| Predicted LogP | 0.9 |
| Melting point | Decomp: 256-257 °C |
| Decomposition | When heated to decomposition it emits toxic fumes of /Nitrogen oxide/. |
| Solubility | Practically insol in ether, acetone, dil hydrochloric acid; sol in propylene glycol (1%) and hot alcohol |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-amino-5-phenyl-1,3-oxazol-4-one |
| SMILES | C1=CC=C(C=C1)C2C(=O)N=C(O2)N |
| InChI | InChI=1S/C9H8N2O2/c10-9-11-8(12)7(13-9)6-4-2-1-3-5-6/h1-5,7H,(H2,10,11,12) |
| InChIKey | NRNCYVBFPDDJNE-UHFFFAOYSA-N |
Pemoline
Pemoline (also known as Phenoxazole, Phenylisohydantoin, Azoksodon, Fenoxazol, Azoxodon, Dantromin, Cylert, Pemolin, Tradon or Azoxodone) is a stimulant substance of the aminorex class.