Bluedark| Paracetamol | |
|---|---|
 | |
| Molecular structure via molpic | |
|
| |
| Molecular formula | C8H9NO2 |
| Molecular mass | 151.16 g/mol |
| Density | 1.293 at 70 °F (NTP, 1992) - Denser than water; will sink g/cm3 |
| Appearance | Large monoclinic prisms from water |
| Odor | Odorless |
| Taste | Slightly bitter taste |
| Predicted LogP | 0.5 |
| Melting point | 336 to 342 °F (NTP, 1992) |
| Boiling point | >500 |
| Solubility | >22.7 [ug/mL] (The mean of the results at pH 7.4) |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | N-(4-hydroxyphenyl)acetamide |
| SMILES | CC(=O)NC1=CC=C(C=C1)O |
| InChI | InChI=1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) |
| InChIKey | RZVAJINKPMORJF-UHFFFAOYSA-N |
Paracetamol
Paracetamol (also known as acetaminophen, 4-Acetamidophenol, Tylenol, N-(4-Hydroxyphenyl)acetamide, APAP, Panadol, N-Acetyl-p-aminophenol, 4'-Hydroxyacetanilide, Acetaminofen or Datril)