Bluedark| Nicotine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C10H14N2 |
| Molecular mass | 162.23 g/mol |
| Density | 1.0097 at 68 °F (EPA, 1998) - Denser than water; will sink g/cm3 |
| Appearance | Colorless to pale yellow, oily liquid |
| Odor | Fish-like odor when warm |
| Taste | Acrid, burning |
| Predicted LogP | 1.2 |
| Melting point | -110 °F (EPA, 1998) |
| Boiling point | 476.1 ° |
| Decomposition | When heated to decomp it emits /nitrogen oxides, carbon monoxide/ and other highly toxic fumes. ... |
| Solubility | Miscible (NTP, 1992) |
| Identifiers [] | |
|---|---|
| IUPAC name | 3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| Cannonical SMILES | CN1CCCC1C2=CN=CC=C2 |
| InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1 |
| InChIKey | SNICXCGAKADSCV-JTQLQIEISA-N |
Nicotine
Nicotine (also known as L-Nicotine, (-)-Nicotine, (S)-Nicotine, (S)-3-(1-methylpyrrolidin-2-yl)pyridine, (S)-(-)-Nicotine, Habitrol, Nicotrol, Nicoderm, Nicotine polacrilex or Fumetobac)