Bluedark| Nandrolone | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C18H26O2 |
| Molecular mass | 274.4 g/mol |
| Appearance | Dimorphic crystals |
| Predicted LogP | 2.6 |
| Melting point | 112 and 124 °C |
| Solubility | Soluble in ether, chloroform, and alcohol |
| Identifiers [] | |
|---|---|
| IUPAC name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| Cannonical SMILES | CC12CCC3C(C1CCC2O)CCC4=CC(=O)CCC34 |
| InChI | InChI=1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1 |
| InChIKey | NPAGDVCDWIYMMC-IZPLOLCNSA-N |
Nandrolone
Nandrolone (also known as 19-Nortestosterone, 19-Norandrostenolone, Norandrostenolone, Nortestosterone, Menidrabol, Nandrolon, Nortestonate, Oestrenolon, Norandrostenolon or 17beta-Hydroxy-4-estren-3-one) is a substance of the steroid class.