N-Ethylpentedrone
| N-Ethylpentedrone | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C13H19NO |
| Molecular mass | 205.30 g/mol |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-(ethylamino)-1-phenylpentan-1-one |
| Cannonical SMILES | CCCC(C(=O)C1=CC=CC=C1)NCC |
| InChI | InChI=1S/C13H19NO/c1-3-8-12(14-4-2)13(15)11-9-6-5-7-10-11/h5-7,9-10,12,14H,3-4,8H2,1-2H3 |
| InChIKey | QQAHEGDXEXIQPR-UHFFFAOYSA-N |
| Dosing |
|---|
| Insufflated [] | |
|---|---|
| Threshold | 1 - 4.2 mg |
| Light | 4.2 - 15 mg |
| Common | 15 - 20 mg |
| Strong | 20 - 21 mg |
| Heavy | 21 - 27 mg |
| Statistically derived dosages by Sernyl |
N-Ethylpentedrone (also known as 2-(Ethylamino)-1-phenyl-1-pentanone, 1-Pentanone, 2-(ethylamino)-1-phenyl-, J3.131.462C, alpha-Eapp, N-ethyl-Pentedrone, EAPP, N-ethylaminopentiophenone, .ALPHA.-EAPP, alpha-Ethylaminopentiophenone or .ALPHA.-ETHYLAMINOPENTIOPHENONE) is a stimulant substance of the methcathinone class.
Chemistry
N-Ethylpentedrone is typically prepared in the form of its amine salts .alpha.-ethylaminopentiophenone hydrochloride.
N-Ethylpentedrone is a racemic mixture of two optical stereoisomers.