Morphine
| Morphine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C17H19NO3 |
| Molecular mass | 285.34 g/mol |
| Density | 1.32 g/cm3 |
| Appearance | Prisms |
| Odor | Odorless |
| Taste | Bitter |
| Melting point | 255 °C |
| Boiling point | 190ºC |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxide/. |
| Solubility | In water, 1.49X10+2 mg/L at 20 °C |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol |
| Cannonical SMILES | CN1CCC23C4C1CC5=C2C(=C(C=C5)O)OC3C(C=C4)O |
| InChI | InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 |
| InChIKey | BQJCRHHNABKAKU-KBQPJGBKSA-N |
| Dosing |
|---|
| Intravenous [] | |
|---|---|
| Threshold | 4 - 5.6 mg |
| Light | 5.6 - 12 mg |
| Common | 12 - 16 mg |
| Strong | 16 - 30 mg |
| Heavy | 30 mg |
| Insufflated [] | |
|---|---|
| Threshold | 0.5 - 8.4 mg |
| Light | 8.4 - 15 mg |
| Common | 15 - 30 mg |
| Strong | 30 - 50 mg |
| Heavy | 50 - 60 mg |
| Oral [] | |
|---|---|
| Threshold | 1 - 9.000000000000002 mg |
| Light | 9.000000000000002 - 20 mg |
| Common | 20 - 40 mg |
| Strong | 40 - 60 mg |
| Heavy | 60 - 100 mg |
| Statistically derived dosages by Sernyl |
Morphine (also known as Morphia, Morphium, Morphin, Morphinum, (-)-Morphine, Morphina, Ospalivina, Duromorph, Meconium or Morphinism) is a opioid substance of the morphinan class.
Chemistry
Morphine is typically prepared in the form of its amine salts acetate, oleate, methylsulfonate, hydrobromide dihydrate, hydrochloride trihydrate, hydrochloride, phosphate, sulfate, nitrate, sulfate anhydrous, tartrate, hypophosphite, hydriodide dihydrate, hydrobromide, hydriodide, phosphate hemihydrate and monohydrate.
Morphine is a absolute mixture