Mirtazapine
| Mirtazapine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C17H19N3 |
| Molecular mass | 265.35 g/mol |
| Melting point | 114-116 °C |
| Solubility | slightly soluble in water |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
| Cannonical SMILES | CN1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4 |
| InChI | InChI=1S/C17H19N3/c1-19-9-10-20-16(12-19)15-7-3-2-5-13(15)11-14-6-4-8-18-17(14)20/h2-8,16H,9-12H2,1H3 |
| InChIKey | RONZAEMNMFQXRA-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 3.5 - 15 mg |
| Light | 15 mg |
| Common | 15 mg |
| Strong | 15 - 30 mg |
| Heavy | 30 - 45 mg |
| Statistically derived dosages by Sernyl |
Mirtazapine (also known as Remeron, 61337-67-5, Zispin, 6-Azamianserin, Mepirzepine, Remergil, Promyrtil, Remergon, Norset or Rexer) is a depressant substance of the phenethylamine class.
Chemistry
Mirtazapine is typically prepared in the form of its amine salts hemihydrate, hydrobromide and hydrochloride.
Mirtazapine is a racemic mixture of two optical stereoisomers.