Bluedark| Midazolam | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C18H13ClFN3 |
| Molecular mass | 325.8 g/mol |
| Appearance | Colorless crystals from ether/methylene chloride/ hexane |
| Predicted LogP | 2.5 |
| Melting point | 161-164 |
| Boiling point | 496.9±55.0 |
| Decomposition | When heated to decomposition it emits toxic fumes of /hydrogen fluoride, hydrogen chloride and nitrogen oxides/. |
| Solubility | 54mg/L |
| Identifiers [] | |
|---|---|
| IUPAC name | 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine |
| Cannonical SMILES | CC1=NC=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4F |
| InChI | InChI=1S/C18H13ClFN3/c1-11-21-9-13-10-22-18(14-4-2-3-5-16(14)20)15-8-12(19)6-7-17(15)23(11)13/h2-9H,10H2,1H3 |
| InChIKey | DDLIGBOFAVUZHB-UHFFFAOYSA-N |
Midazolam
Midazolam (also known as Dormicum, Buccolam, Midazolamum, Versed, 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine, mezolam, Midazolamum [INN-Latin], Midazolam Base, Nayzilam or Midazolam civ) is a depressant substance of the benzodiazepine class.