Bluedark| MXP | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C20H25NO |
| Molecular mass | 295.4 g/mol |
| Predicted LogP | 4.6 |
| Identifiers [] | |
|---|---|
| IUPAC name | 1-[1-(2-methoxyphenyl)-2-phenylethyl]piperidine |
| Cannonical SMILES | COC1=CC=CC=C1C(CC2=CC=CC=C2)N3CCCCC3 |
| InChI | InChI=1S/C20H25NO/c1-22-20-13-7-6-12-18(20)19(21-14-8-3-9-15-21)16-17-10-4-2-5-11-17/h2,4-7,10-13,19H,3,8-9,14-16H2,1H3 |
| InChIKey | QXXCUXIRBHSITD-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 10 - 38 mg |
| Light | 38 - 45 mg |
| Common | 45 - 85 mg |
| Strong | 85 - 100 mg |
| Heavy | 100 - 150 mg |
| Statistically derived dosages by Sernyl |
Methoxphenidine
Methoxphenidine (also known as Methoxydiphenidine, 2-Meo-diphenidine, Piperidine, 1-(1-(2-methoxyphenyl)-2-phenylethyl)-, Piperidine, 1-(1-(2-methoxyphenyl)-2-phenylethyl)-, (+/-)-, MXP, Methoxphenidine (hydrochloride) or 1-(1-(2-Methoxyphenyl)-2-phenylethyl)piperidine) is a substance of the diarylethylamine class.