Loperamide
| Loperamide | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C29H33ClN2O2 |
| Molecular mass | 477.0 g/mol |
| Melting point | 220-228 |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| Cannonical SMILES | CN(C)C(=O)C(CCN1CCC(CC1)(C2=CC=C(C=C2)Cl)O)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | InChI=1S/C29H33ClN2O2/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23/h3-16,34H,17-22H2,1-2H3 |
| InChIKey | RDOIQAHITMMDAJ-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 2 mg |
| Light | 2 - 8 mg |
| Common | 8 - 18 mg |
| Strong | 18 - 36 mg |
| Heavy | 36 - 60 mg |
| Statistically derived dosages by Sernyl |
Loperamide (also known as Loperamida, Ioperamide, Loperamidum, Loperamidum [INN-Latin], Loperamida [INN-Spanish], EINECS 258-416-5, Loperamide (INN), BRN 1558273, CHEBI:6532 or 4-(4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl)-N,N-dimethyl-2,2-diphenylbutanamide)
Chemistry
Loperamide is typically prepared in the form of its amine salts hydrochloride.
Loperamide is a achiral mixture