L-Tryptophan
| L-Tryptophan | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C11H12N2O2 |
| Molecular mass | 204.22 g/mol |
| Appearance | Leaflets or plates from dilute alcohol |
| Odor | Odorless |
| Taste | FLAT TASTE |
| Melting point | 554 to 558 °F (Decomposes) (NTP, 1992) |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitric oxide/. |
| Solubility | 1 to 5 mg/mL at 68 °F (NTP, 1992) |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid |
| Cannonical SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | QIVBCDIJIAJPQS-VIFPVBQESA-N |
L-Tryptophan (also known as L-tryptophan, tryptophan, 73-22-3, h-Trp-oh, L-Tryptophane, Tryptophane, (S)-Tryptophan, trofan, tryptacin or Ardeytropin) is a depressant substance of the phenethylamine class.
Chemistry
L-Tryptophan is a absolute mixture