Fluoxetine
| Fluoxetine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C17H18F3NO |
| Molecular mass | 309.33 g/mol |
| Melting point | 179 - 182 °C |
| Boiling point | 395.1°C at 760 mmHg |
| Solubility | insoluble |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine |
| Cannonical SMILES | CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO/c1-21-12-11-16(13-5-3-2-4-6-13)22-15-9-7-14(8-10-15)17(18,19)20/h2-10,16,21H,11-12H2,1H3 |
| InChIKey | RTHCYVBBDHJXIQ-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 mg |
| Light | 1 - 17.5 mg |
| Common | 17.5 - 20 mg |
| Strong | 20 - 40 mg |
| Heavy | 40 - 80 mg |
| Statistically derived dosages by Sernyl |
Fluoxetine (also known as Prozac, Fluoxetina, Pulvules, Eufor, Animex-On, Fluoxetin, Fluval, Portal, Fluoxetinum or Fluoxetina [Spanish]) is a depressant substance of the amine class.
Chemistry
Fluoxetine is typically prepared in the form of its amine salts hydrochloride and oxalate.
Fluoxetine is a racemic mixture of two optical stereoisomers.