Finasteride | |
---|---|
Molecular structure via molpic | |
| |
Molecular formula | C23H36N2O2 |
Molecular mass | 372.5 g/mol |
Appearance | White to off-white crystalline solid |
Predicted LogP | 3 |
Melting point | 252-254 °C |
Solubility | 52.8 [ug/mL] (The mean of the results at pH 7.4) |
Chirality | absolute |
Identifiers [] | |
---|---|
IUPAC name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-N-tert-butyl-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxamide |
SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)NC(C)(C)C)CC[C@@H]4[C@@]3(C=CC(=O)N4)C |
InChI | InChI=1S/C23H36N2O2/c1-21(2,3)25-20(27)17-8-7-15-14-6-9-18-23(5,13-11-19(26)24-18)16(14)10-12-22(15,17)4/h11,13-18H,6-10,12H2,1-5H3,(H,24,26)(H,25,27)/t14-,15-,16-,17+,18+,22-,23+/m0/s1 |
InChIKey | DBEPLOCGEIEOCV-WSBQPABSSA-N |
Finasteride
Finasteride (also known as Proscar, Propecia, Finastid, Prostide, Chibro-Proscar, MK-906, Finasterida, Finpecia, Finasteridum or MK 906) is a substance of the steroid class.