Bluedark| Ethylmorphine | |
|---|---|
 |
| Salts [] | |
|---|---|
| Ethylmorphine hydrochloride | |
| |
| Ethylmorphine hydrochloride dihydrate | |
| |
| Ethylmorphine camsilate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C19H23NO3 |
|---|---|
| Molecular mass | 313.4 g/mol |
| Predicted LogP | 1.5 |
| Melting point | 199-201 °C |
| Solubility | 8.35e-01 g/L |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (4R,4aR,7S,7aR,12bS)-9-ethoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| SMILES | CCOC1=C2C3=C(C[C@@H]4[C@H]5[C@]3(CCN4C)[C@@H](O2)[C@H](C=C5)O)C=C1 |
| InChI | InChI=1S/C19H23NO3/c1-3-22-15-7-4-11-10-13-12-5-6-14(21)18-19(12,8-9-20(13)2)16(11)17(15)23-18/h4-7,12-14,18,21H,3,8-10H2,1-2H3/t12-,13+,14-,18-,19-/m0/s1 |
| InChIKey | OGDVEMNWJVYAJL-LEPYJNQMSA-N |
Ethylmorphine
Ethylmorphine (also known as Codethyline, DIONINE, 3-Ethoxymorphine, 3-O-Ethylmorphine, Morphine, ethyl-, Ethyl morphine, Ethylmorphine [BAN], RWO67D87EU, Dionin or Ethylmorphine (BAN)) is a opioid substance of the morphinan class.
Chemistry
Ethylmorphine is typically found in the form of its hydrochloride, hydrochloride dihydrate, dihydrate and camsilate salts.