E3 | |
---|---|
| |
Molecular structure via molpic | |
Molecular formula | C18H24O3 |
Molecular mass | 288.4 g/mol |
Density | 1.27 g/cu cm at 25 °C g/cm3 |
Appearance | Leaflets from alcohol |
Odor | Odorless |
Predicted LogP | 2.5 |
Melting point | 82-86 |
Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. |
Solubility | Slightly soluble in ethyl ether, benzene, trifluoroacetic acid; very soluble in pyridine |
Identifiers [] | |
---|---|
IUPAC name | (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
Cannonical SMILES | CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O |
InChI | InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1 |
InChIKey | PROQIPRRNZUXQM-ZXXIGWHRSA-N |
Estriol
Estriol (also known as Oestriol, Trihydroxyestrin, Aacifemine, Estratriol, Ovestrion, Destriol, Ovestin, Theelol, Tridestrin or Oestratriol) is a hormone substance of the steroid class.