Bluedark| E2 | |
|---|---|
 |
| Salts [] | |
|---|---|
| Sodium estradiol | |
|
| Esters [] | |
|---|---|
| Estradiol acetate | |
| |
| Estradiol benzoate | |
| |
| Estradiol valerate | |
| |
| Estradiol cypionate | |
| |
| Estradiol enantate | |
| |
| Estradiol undecylate | |
| |
| Estradiol diundecylate | |
| |
| Estradiol propionate | |
| |
| Estradiol dipropionate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C18H24O2 |
|---|---|
| Molecular mass | 272.4 g/mol |
| Appearance | White crystalline powder. Prisms from 80% alcohol |
| Odor | Odorless |
| Predicted LogP | 4 |
| Melting point | 178.5 °C |
| Boiling point | 445.9±45.0 |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. |
| Solubility | Very soluble in acetone, ethanol, dioxane |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | VOXZDWNPVJITMN-ZBRFXRBCSA-N |
Estradiol
(Redirected from Estradiol cypionate)
Estradiol (also known as beta-Estradiol, 17beta-Estradiol, Oestradiol, Dihydrofolliculin, Estrace, Vivelle, progynon, Diogynets, Ovocyclin or Aquadiol) is a hormone substance of the steroid class.
Chemistry
Estradiol is typically found in the form of its sodium salt or its acetate, benzoate, valerate, cypionate, enantate, undecylate, diundecylate, propionate and dipropionate esters.