Estradiol
| Estradiol | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C18H24O2 |
| Molecular mass | 272.4 g/mol |
| Appearance | White crystalline powder. Prisms from 80% alcohol |
| Odor | Odorless |
| Melting point | 178.5 °C |
| Boiling point | 445.9±45.0 |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. |
| Solubility | Very soluble in acetone, ethanol, dioxane |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| Cannonical SMILES | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O |
| InChI | InChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | VOXZDWNPVJITMN-ZBRFXRBCSA-N |
Estradiol (also known as beta-Estradiol, 17beta-Estradiol, Oestradiol, Dihydrofolliculin, Estrace, Vivelle, progynon, Diogynets, Ovocyclin or Aquadiol) is a steroid substance of the estrone class.
Chemistry
Estradiol is typically prepared in the form of its amine salts sodium estradiol and hemihydrate.
Estradiol is a absolute mixture