Bluedark| Adrenaline | |
|---|---|
 |
| Salts [] | |
|---|---|
| Epinephrine sulfate | |
| |
| Epinephrine acetate | |
| |
| Epinephrine tartrate | |
| |
| Epinephrine bitartrate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular mass | 183.20 g/mol |
| Appearance | Brown (in air) |
| Odor | Odorless |
| Predicted LogP | -1.4 |
| Melting point | 412 to 414 °F (NTP, 1992) |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. |
| Solubility | less than 0.1 mg/mL at 64 °F (NTP, 1992) |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
| SMILES | CNC[C@@H](C1=CC(=C(C=C1)O)O)O |
| InChI | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1 |
| InChIKey | UCTWMZQNUQWSLP-VIFPVBQESA-N |
Epinephrine
Epinephrine (also known as adrenaline, l-Adrenaline, L-epinephrine, Adrenalin, Levoepinephrine, Epinefrina, Nephridine, Adnephrine, Chelafrin or Epinephran) is a substance of the phenethylamine class.
Chemistry
Epinephrine is typically found in the form of its sulfate, acetate, tartrate and bitartrate salts.