Bluedark| Diclofenac | |
|---|---|
 |
| Salts [] | |
|---|---|
| Sodium diclofenac | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C14H11Cl2NO2 |
|---|---|
| Molecular mass | 296.1 g/mol |
| Appearance | Crystals from ether-petroleum ether |
| Predicted LogP | 4.4 |
| Melting point | 283-285 °C |
| Solubility | In water, 2.37 mg/L at 25 °C |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-[2-(2,6-dichloroanilino)phenyl]acetic acid |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=CC=C2Cl)Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19) |
| InChIKey | DCOPUUMXTXDBNB-UHFFFAOYSA-N |
Diclofenac
Diclofenac (also known as Diclofenac acid, dichlofenac, Diclofenaco, Diclophenac, Diclofenacum, 2-(2-((2,6-Dichlorophenyl)amino)phenyl)acetic acid, ProSorb-D, Diclofenac free acid, 2-(2,6-Dichloroanilino)phenylacetic Acid or Voltarol) is a substance of the gabapentinoid class.
Chemistry
Diclofenac is typically found in the form of its sodium salt.