Diazepam
| Diazepam | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C16H13ClN2O |
| Molecular mass | 284.74 g/mol |
| Appearance | Colorless to light yellow crysytals |
| Odor | Practically no odor |
| Melting point | 257 to 259 °F (NTP, 1992) |
| Decomposition | When heated to decomp it emits very toxic fumes of hydrogen chloride and NO(x) |
| Solubility | less than 1 mg/mL at 68 °F (NTP, 1992) |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 7-chloro-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| Cannonical SMILES | CN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3 |
| InChI | InChI=1S/C16H13ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChIKey | AAOVKJBEBIDNHE-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 2 mg |
| Light | 2 - 5 mg |
| Common | 5 - 10 mg |
| Strong | 10 - 15 mg |
| Heavy | 15 - 20 mg |
| Statistically derived dosages by Sernyl |
Diazepam (also known as Valium, Ansiolisina, Diazemuls, Alboral, Apaurin, Faustan, Relanium, Seduxen, Sibazon or Stesolid) is a depressant substance of the amine class.
Chemistry
Diazepam is typically prepared in the form of its amine salts hydrochloride.
Diazepam is a achiral mixture