Diacetylmorphine
| Diacetylmorphine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C21H23NO5 |
| Molecular mass | 369.4 g/mol |
| Density | 1.56 g/cm3 |
| Appearance | Orthorhombic plates, tablets from ethyl acetate |
| Odor | Odorless |
| Taste | Bitter |
| Melting point | 173 °C |
| Boiling point | 272-274 °C at 1.20E+01 mm Hg |
| Decomposition | ... Decomposes by boiling with water. |
| Solubility | In water, 60 mg/L at 25 °C |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | [(4R,4aR,7S,7aR,12bS)-9-acetyloxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| Cannonical SMILES | CC(=O)OC1C=CC2C3CC4=C5C2(C1OC5=C(C=C4)OC(=O)C)CCN3C |
| InChI | InChI=1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1 |
| InChIKey | GVGLGOZIDCSQPN-PVHGPHFFSA-N |
Diacetylmorphine (also known as HEROIN, Diamorphine, Acetomorphine, 3,6-Diacetylmorphine, Diaphorm, Eclorion, Morphacetin, O,O'-Diacetylmorphine, Preza or Morphine diacetate) is a opioid substance of the morphinan class.
Chemistry
Diacetylmorphine is typically prepared in the form of its amine salts diamorphine hydrochloride anhydrous.
Diacetylmorphine is a absolute mixture