DXM | |
---|---|
Salts [] | |
---|---|
Dextromethorphan hydriodide | |
Dextromethorphan salicylate | |
Dextromethorphan hydrobromide | |
Dextromethorphan hydrochloride | |
Molecular structure via molpic | |
| |
Molecular formula | C18H25NO |
---|---|
Molecular mass | 271.4 g/mol |
Appearance | White to slightly yellow crystalline powder |
Odor | Odorless |
Predicted LogP | 3.4 |
Melting point | 122-124 |
Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. |
Solubility | Practically insoluble in water |
Chirality | absolute |
Identifiers [] | |
---|---|
IUPAC name | (1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1CC4=C3C=C(C=C4)OC |
InChI | InChI=1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m1/s1 |
InChIKey | MKXZASYAUGDDCJ-NJAFHUGGSA-N |
Dextromethorphan
Dextromethorphan (also known as d-Methorphan, delta-Methorphan, Dextromorphan, Dextromethorfan, Dextrometorfano, Dextromethorphane, Albutussin, Destrometerfano, Dextromethorphanum or BA 2666) is a opioid substance of the morphinan class.
Chemistry
Dextromethorphan is typically found in the form of its hydriodide, salicylate, hydrobromide and hydrochloride salts.
Stereochemistry
Dextromethorphan is a absolute mixtureSee also
External links
- Dextromethorphan (Wikipedia)
- Dextromethorphan (Wikidata)
- Dextromethorphan (DrugBank)
- Dextromethorphan (PubChem)
- Dextromethorphan (ChemSpider)
- Dextromethorphan (ChEMBL)
- Dextromethorphan (ChEBI)
- Dextromethorphan (Common Chemistry)
- Dextromethorphan (KEGG)
- Dextromethorphan (UNII)
- Dextromethorphan (EPA DSSTox)