Dextromethorphan
| Dextromethorphan | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C18H25NO |
| Molecular mass | 271.4 g/mol |
| Appearance | White to slightly yellow crystalline powder |
| Odor | Odorless |
| Melting point | 122-124 |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. |
| Solubility | Practically insoluble in water |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (1S,9S,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| Cannonical SMILES | CN1CCC23CCCCC2C1CC4=C3C=C(C=C4)OC |
| InChI | InChI=1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m1/s1 |
| InChIKey | MKXZASYAUGDDCJ-NJAFHUGGSA-N |
Dextromethorphan (also known as d-Methorphan, delta-Methorphan, Dextromorphan, Dextromethorfan, Dextrometorfano, Dextromethorphane, Albutussin, Destrometerfano, Dextromethorphanum or BA 2666) is a opioid substance of the amphetamine class.
Chemistry
Dextromethorphan is typically prepared in the form of its amine salts hydriodide, salicylate, hydrobromide anhydrous, hydrochloride, tannate and hydrobromide.
Dextromethorphan is a absolute mixture