Deschloroketamine
| Deschloroketamine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C13H17NO |
| Molecular mass | 203.28 g/mol |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-(methylamino)-2-phenylcyclohexan-1-one |
| Cannonical SMILES | CNC1(CCCCC1=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C13H17NO/c1-14-13(10-6-5-9-12(13)15)11-7-3-2-4-8-11/h2-4,7-8,14H,5-6,9-10H2,1H3 |
| InChIKey | ZAGBSZSITDFFAF-UHFFFAOYSA-N |
| Dosing |
|---|
| Insufflated [] | |
|---|---|
| Threshold | 2 - 4.800000000000001 mg |
| Light | 4.800000000000001 - 10 mg |
| Common | 10 - 25 mg |
| Strong | 25 - 50 mg |
| Heavy | 50 - 84 mg |
| Rectal [] | |
|---|---|
| Threshold | 8 mg |
| Light | 8 - 10 mg |
| Common | 10 mg |
| Strong | 10 - 20 mg |
| Heavy | 20 - 25 mg |
| Statistically derived dosages by Sernyl |
Deschloroketamine (also known as 2'-Oxo-pcm, S-deschloroketamine, 2-(Methylamino)-2-phenylcyclohexanone, Cyclohexanone, 2-(methylamino)-2-phenyl-, DXE, S-DCK, SCHEMBL8154269, CHEMBL2068808, GTPL11720 or NS00018082) is a substance of the amine class.
Chemistry
Deschloroketamine is typically prepared in the form of its amine salts hydrochloride.
Deschloroketamine is a racemic mixture of two optical stereoisomers.