Bromazepam
| Bromazepam | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C14H10BrN3O |
| Molecular mass | 316.15 g/mol |
| Solubility | 3.99e-02 g/L |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 7-bromo-5-pyridin-2-yl-1,3-dihydro-1,4-benzodiazepin-2-one |
| Cannonical SMILES | C1C(=O)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=N3 |
| InChI | InChI=1S/C14H10BrN3O/c15-9-4-5-11-10(7-9)14(17-8-13(19)18-11)12-3-1-2-6-16-12/h1-7H,8H2,(H,18,19) |
| InChIKey | VMIYHDSEFNYJSL-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 1.5 - 3 mg |
| Light | 3 - 6 mg |
| Common | 6 - 9 mg |
| Strong | 9 - 19.5 mg |
| Heavy | 19.5 - 24 mg |
| Statistically derived dosages by Sernyl |
Bromazepam (also known as Lexotanil, Compedium, Durazanil, Lectopam, Lexotan, Creosedin, Lekotam, Lexaurin, Lexilium or Calmepam) is a depressant substance of the amine class.
Chemistry
Bromazepam is a achiral mixture