Bluedark| Strychnine | |
|---|---|
 |
| Salts [] | |
|---|---|
| Strychnine sulfate | |
| |
| Strychnine tartrate | |
| |
| Strychnine nitrate | |
| |
| Strychnine hydrochloride | |
| |
| Strychnine hydrochloride dihydrate | |
| |
| Strychnine hypophosphite | |
| |
| Strychnine valerate | |
| |
| Strychnine arsenate | |
| |
| Strychnine sulfate pentahydrate | |
| |
| Strychnine phosphate | |
| |
| Strychnine phosphate dihydrate | |
|
| Esters [] | |
|---|---|
| Strychnine valerate | |
|
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C21H22N2O2 |
|---|---|
| Molecular mass | 334.4 g/mol |
| Density | 1.36 at 68 °F (EPA, 1998) - Denser than water; will sink g/cm3 |
| Appearance | Brilliant, colorless cubes from chloroform-ether |
| Odor | Odorless |
| Taste | Very bitter metallic taste |
| Predicted LogP | 1.9 |
| Melting point | 514 to 554 °F (EPA, 1998) |
| Boiling point | 518 ° |
| Decomposition | Hazardous decomposition products formed under fire conditions - Carbon oxides, nitrogen oxides (NOx). |
| Solubility | 0.02 % (NIOSH, 2024) |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (4aR,5aS,8aR,13aS,15aS,15bR)-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
| SMILES | C1CN2CC3=CCO[C@H]4CC(=O)N5[C@H]6[C@H]4[C@H]3C[C@H]2[C@@]61C7=CC=CC=C75 |
| InChI | InChI=1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1 |
| InChIKey | QMGVPVSNSZLJIA-FVWCLLPLSA-N |
Strychnine
Strychnine (also known as Strychnidin-10-one, (-)-Strychnine, Sanaseed, Strychnin, Strychninum, Estricnina, Strychinos, Gopher bait, Gopher-gitter or Boomer-rid)
Chemistry
Strychnine is typically found in the form of its sulfate, tartrate, nitrate, hydrochloride, hydrochloride dihydrate, arsenate dihydrate, hypophosphite, valerate, arsenate, sulfate pentahydrate, phosphate, phosphate dihydrate and hypophosphite dihydrate salts or its valerate ester.