Sertraline
| Sertraline | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C17H17Cl2N |
| Molecular mass | 306.2 g/mol |
| Melting point | 245-246 |
| Boiling point | 416.3±45.0 °C |
| Solubility | >45.9 [ug/mL] (The mean of the results at pH 7.4) |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| Cannonical SMILES | CNC1CCC(C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl |
| InChI | InChI=1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m0/s1 |
| InChIKey | VGKDLMBJGBXTGI-SJCJKPOMSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 6.400000000000001 mg |
| Light | 6.400000000000001 - 50 mg |
| Common | 50 - 100 mg |
| Strong | 100 - 137.5 mg |
| Heavy | 137.5 - 200 mg |
| Statistically derived dosages by Sernyl |
Sertraline (also known as Sertralina, Sertralinum, (+)-Sertraline, Sertralinum [Latin], Cp 51974, cis-(+)-sertraline, (1S,4S)-sertraline, HSDB 7037, (1S-cis)-1,2,3,4-Tetrahydro-4-(3,4-dichlorophenyl)-N-methyl-1-naphthalenamine or Sertraline (INN)) is a depressant substance of the amine class.
Chemistry
Sertraline is typically prepared in the form of its amine salts hydrochloride.
Sertraline is a absolute mixture