Bluedark| 5-HT | |
|---|---|
 |
| Salts [] | |
|---|---|
| Serotonin hydrochloride | |
| |
| Serotonin adipate | |
|
| Esters [] | |
|---|---|
| Serotonin propionate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C10H12N2O |
|---|---|
| Molecular mass | 176.21 g/mol |
| Predicted LogP | 0.2 |
| Solubility | 25.5 mg/mL |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 3-(2-aminoethyl)-1H-indol-5-ol |
| SMILES | C1=CC2=C(C=C1O)C(=CN2)CCN |
| InChI | InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
| InChIKey | QZAYGJVTTNCVMB-UHFFFAOYSA-N |
Serotonin
Serotonin (also known as 5-HYDROXYTRYPTAMINE, 3-(2-Aminoethyl)-1H-indol-5-ol, Enteramine, Thrombotonin, Thrombocytin, Antemovis, Serotonine, Ds substance, Antemoqua or Hippophain) is a antidepressant substance of the tryptamine class.
Chemistry
Serotonin is typically found in the form of its hydrochloride and adipate salts or its propionate ester.