Bluedark| Scopolamine | |
|---|---|
 |
| Salts [] | |
|---|---|
| Scopolamine sulfate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular mass | 303.35 g/mol |
| Appearance | Viscous liquid |
| Predicted LogP | 0.9 |
| Melting point | 387 ° |
| Solubility | greater than or equal to 100 mg/mL at 68 °F (NTP, 1992) |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | [(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate |
| SMILES | CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)C4=CC=CC=C4 |
| InChI | InChI=1S/C17H21NO4/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10/h2-6,11-16,19H,7-9H2,1H3/t11?,12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | STECJAGHUSJQJN-USLFZFAMSA-N |
Scopolamine
Scopolamine (also known as Hyoscine, 51-34-3, (-)-Hyoscine, Scopine (-)-tropate, Scopine tropate, (-)-Scopolamine, Hyosol, Scopace, 6,7-Epoxytropine tropate or Transderm-Scop) is a substance of the piperidine class.
Chemistry
Scopolamine is typically found in the form of its sulfate salt.