Promethazine
| Promethazine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C17H20N2S |
| Molecular mass | 284.4 g/mol |
| Appearance | Crystals |
| Melting point | 140 ° |
| Boiling point | 374 to 379 °F at 3 mmHg (NTP, 1992) |
| Decomposition | When heated to decomposition it emits very toxic fumes of /nitrogen oxides and sulfur oxides/. |
| Solubility | Very soluble in dilute hydrogen chloride |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | N,N-dimethyl-1-phenothiazin-10-ylpropan-2-amine |
| Cannonical SMILES | CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)N(C)C |
| InChI | InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| InChIKey | PWWVAXIEGOYWEE-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 15 mg |
| Light | 15 - 25 mg |
| Common | 25 - 50 mg |
| Strong | 50 - 100 mg |
| Heavy | 100 - 112 mg |
| Statistically derived dosages by Sernyl |
Promethazine (also known as Proazamine, Diphergan, Protazine, Promethazin, Prometazin, Vallergine, Dimapp, Fargan, Procit or Promazinamide) is a anaesthetic substance of the amine class.
Chemistry
Promethazine is typically prepared in the form of its amine salts hibenzate, maleate, teoclate, hydrochloride, methylenedisalicylate and pamoate.
Promethazine is a racemic mixture of two optical stereoisomers.