Oxycodone
| Oxycodone | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C18H21NO4 |
| Molecular mass | 315.4 g/mol |
| Appearance | Rods from ethanol |
| Melting point | 219 °C |
| Decomposition | When heated to decomposition it emits toxic fumes of oxides of nitrogen. |
| Solubility | 166mg/mL |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| Cannonical SMILES | CN1CCC23C4C(=O)CCC2(C1CC5=C3C(=C(C=C5)OC)O4)O |
| InChI | InChI=1S/C18H21NO4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,13,16,21H,5-9H2,1-2H3/t13-,16+,17+,18-/m1/s1 |
| InChIKey | BRUQQQPBMZOVGD-XFKAJCMBSA-N |
| Dosing |
|---|
| Insufflated [] | |
|---|---|
| Threshold | 0.5 - 5 mg |
| Light | 5 - 10 mg |
| Common | 10 - 20 mg |
| Strong | 20 - 27.5 mg |
| Heavy | 27.5 - 40 mg |
| Oral [] | |
|---|---|
| Threshold | 0.5 - 2 mg |
| Light | 2 - 5 mg |
| Common | 5 - 11.25 mg |
| Strong | 11.25 - 20 mg |
| Heavy | 20 - 40 mg |
| Statistically derived dosages by Sernyl |
Oxycodone (also known as Dihydrone, Dihydrohydroxycodeinone, Oxycodeinone, Dihydroxycodeinone, Oxicon, Diphydrone, Eucodalum, Oxycodon, Percobarb or Oxicodona) is a opioid substance of the methamphetamine class.
Chemistry
Oxycodone is typically prepared in the form of its amine salts terephthalate, phosphate, hydrochloride trihydrate, myristate, n-oxide hydrochloride and hydrochloride.
Oxycodone is a absolute mixture