Lorazepam
| Lorazepam | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C15H10Cl2N2O2 |
| Molecular mass | 321.2 g/mol |
| Melting point | 192-194 |
| Solubility | 1.76e-02 g/L |
| Chirality | racemic |
| Identifiers [] | |
|---|---|
| IUPAC name | 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one |
| Cannonical SMILES | C1=CC=C(C(=C1)C2=NC(C(=O)NC3=C2C=C(C=C3)Cl)O)Cl |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-8-5-6-12-10(7-8)13(19-15(21)14(20)18-12)9-3-1-2-4-11(9)17/h1-7,15,21H,(H,18,20) |
| InChIKey | DIWRORZWFLOCLC-UHFFFAOYSA-N |
| Dosing |
|---|
| Oral [] | |
|---|---|
| Threshold | 0.3 - 0.5 mg |
| Light | 0.5 - 1 mg |
| Common | 1 - 2 mg |
| Strong | 2 - 3 mg |
| Heavy | 3 - 4 mg |
| Statistically derived dosages by Sernyl |
Lorazepam (also known as Ativan, o-Chloroxazepam, o-Chlorooxazepam, Temesta, Loraz, Bonatranquan, Anxiedin, Lorabenz, Sedatival or Orfidal) is a depressant substance of the amine class.
Chemistry
Lorazepam is a racemic mixture of two optical stereoisomers.