Lisdexamphetamine
| Lisdexamphetamine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C15H25N3O |
| Molecular mass | 263.38 g/mol |
| Appearance | Golden-colored solid from methanol |
| Melting point | 191-193 |
| Solubility | White to off-white powder. MP 120-122 °C. Solubility in water: 792 mg/mL /Lisdexamfetamine dimethanesulfonate/ |
| Chirality | absolute |
| Identifiers [] | |
|---|---|
| IUPAC name | (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide |
| Cannonical SMILES | CC(CC1=CC=CC=C1)NC(=O)C(CCCCN)N |
| InChI | InChI=1S/C15H25N3O/c1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16/h2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19)/t12-,14-/m0/s1 |
| InChIKey | VOBHXZCDAVEXEY-JSGCOSHPSA-N |
Lisdexamphetamine (also known as Lisdexamfetamine, Lisdexamfetamine [INN], L-lysine-d-amphetamine, lisdexanfetamina, NRP104, L-lysine-dextroamphetamine, HSDB 8277, Lisdexamfetamine (INN), (2S)-2,6-Diamino-N-((1S)-1-methyl-2-phenylethyl)hexanamide or N-((1S)-1-METHYL-2-PHENYLETHYL)-L-LYSINAMIDE and brand names including Vyvanse) is a stimulant substance of the methamphetamine class.
Chemistry
Lisdexamphetamine is typically prepared in the form of its amine salts lisdexamfetamine dimesylate and lisdexamfetamine sulfate.
Lisdexamphetamine is a absolute mixture