Domperidone
| Domperidone | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C22H24ClN5O2 |
| Molecular mass | 425.9 g/mol |
| Melting point | 242.5 °C |
| Solubility | 50.4 [ug/mL] (The mean of the results at pH 7.4) |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 6-chloro-3-[1-[3-(2-oxo-3H-benzimidazol-1-yl)propyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| Cannonical SMILES | C1CN(CCC1N2C3=C(C=C(C=C3)Cl)NC2=O)CCCN4C5=CC=CC=C5NC4=O |
| InChI | InChI=1S/C22H24ClN5O2/c23-15-6-7-20-18(14-15)25-22(30)28(20)16-8-12-26(13-9-16)10-3-11-27-19-5-2-1-4-17(19)24-21(27)29/h1-2,4-7,14,16H,3,8-13H2,(H,24,29)(H,25,30) |
| InChIKey | FGXWKSZFVQUSTL-UHFFFAOYSA-N |
Domperidone (also known as Motilium, Domperidona, Domperidonum, Nauzelin, R 33,812, Domperidonum [INN-Latin], Domperidona [INN-Spanish], R-33812, NSC299589 or NSC-299589) is a substance of the amine class.
Chemistry
Domperidone is typically prepared in the form of its amine salts maleate and acetate.
Domperidone is a achiral mixture