Dimethyltryptamine
| Dimethyltryptamine | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C12H16N2 |
| Molecular mass | 188.27 g/mol |
| Appearance | Crystals ... also reported as plates from ethanol and light petroleum |
| Melting point | 46 °C |
| Boiling point | 60-80 °C |
| Decomposition | When heated to decomposition if emits toxic fumes of /nitrogen oxides/. |
| Solubility | Freely soluble in dilute acetic and dilute mineral acids |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-(1H-indol-3-yl)-N,N-dimethylethanamine |
| Cannonical SMILES | CN(C)CCC1=CNC2=CC=CC=C21 |
| InChI | InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | DMULVCHRPCFFGV-UHFFFAOYSA-N |
Dimethyltryptamine (also known as N,N-DIMETHYLTRYPTAMINE, 2-(3-Indolyl)ethyldimethylamine, 3-(2-Dimethylaminoethyl)indole, 1H-Indole-3-ethanamine, N,N-dimethyl-, 2-(1H-Indol-3-yl)-N,N-dimethylethanamine, N,N-Dimethyl-1H-indole-3-ethylamine, DMT (psychogenic), N,N-dimethyl-1H-Indole-3-ethanamine, DEA No. 7435 or 3-[2-(dimethylamino)ethyl]indole) is a depressant substance of the tryptamine class.
Chemistry
Dimethyltryptamine is typically prepared in the form of its amine salts fumarate and hydrochloride.
Dimethyltryptamine is a achiral mixture