Bluedark| Creatine | |
|---|---|
 |
| Salts [] | |
|---|---|
| Creatine monohydrate | |
| |
| Creatine hydrochloride | |
| |
| Creatine nitrate | |
|
| Molecular structure via molpic | |
|
| |
| Molecular formula | C4H9N3O2 |
|---|---|
| Molecular mass | 131.13 g/mol |
| Density | 1.33 at 25 °C g/cm3 |
| Predicted LogP | -1.2 |
| Melting point | Decomposes at 303 °C |
| Solubility | Slightly soluble in water, insoluble in ether |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 2-[carbamimidoyl(methyl)amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=N)N |
| InChI | InChI=1S/C4H9N3O2/c1-7(4(5)6)2-3(8)9/h2H2,1H3,(H3,5,6)(H,8,9) |
| InChIKey | CVSVTCORWBXHQV-UHFFFAOYSA-N |
Creatine
Creatine (also known as Creatin, Kreatin, N-amidinosarcosine, Krebiozon, N-methyl-N-guanylglycine, 2-(1-Methylguanidino)acetic acid, methylglycocyamine, Glycine, N-(aminoiminomethyl)-N-methyl-, Creatine, hydrate or Pyrolysate)
Chemistry
Creatine is typically found in the form of its monohydrate, hydrochloride and nitrate salts.