Aripiprazole
Aripiprazole | |
---|---|
Molecular structure via molpic | |
Molecular formula | C23H27Cl2N3O2 |
Molecular mass | 448.4 g/mol |
Appearance | Colorless, flake crystals from ethanol |
Melting point | 137-140 |
Boiling point | 139.0-139.5 °C |
Solubility | <0.3 [ug/mL] (The mean of the results at pH 7.4) |
Chirality | achiral |
Identifiers [] | |
---|---|
IUPAC name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
Cannonical SMILES | C1CC(=O)NC2=C1C=CC(=C2)OCCCCN3CCN(CC3)C4=C(C(=CC=C4)Cl)Cl |
InChI | InChI=1S/C23H27Cl2N3O2/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18/h3-6,8,16H,1-2,7,9-15H2,(H,26,29) |
InChIKey | CEUORZQYGODEFX-UHFFFAOYSA-N |
Aripiprazole (also known as Abilify, Abilitat, Abilify Discmelt, aripiprazol, OPC-14597, Discmelt, Aripiprex, Abilify MyCite, OPC 31 or Abilify Maintena) is a depressant substance of the amine class.
Chemistry
Aripiprazole is typically prepared in the form of its amine salts monohydrate.
Aripiprazole is a achiral mixture